ChemNet > CAS > 249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile
249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile
Nama produk |
3-[2,3-di(benzyloxy)phenyl]propanenitrile |
Sinonim |
3-[2,3-bis(benzyloxy)phenyl]propanenitrile |
MF |
C23H21NO2 |
Berat Molekul |
343.4183 |
InChI |
InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 |
CAS NO |
249278-33-9 |
Struktur Molekul |
|
Kepadatan |
1.138g/cm3 |
Titik lebur |
200℃ |
Titik didih |
525.9°C at 760 mmHg |
Indeks bias |
1.596 |
Titik nyala |
174.5°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|